CAS 879713-65-2 appears in our catalog under these names: 7-Bromo-1,1,2-trimethyl-1H-benzo[e]indole 97%, 7-Bromo-1,1,2-trimethyl-1H-benzo[e]indole, 97%, 97%, 7-Bromo-1,1,2-trimethyl-1H-benzo[e]indole. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 15g, 25g.
7-bromo-1,1,2-trimethylbenzo[e]indole (CAS 879713-65-2) is a chemical compound with the molecular formula C15H14BrN and a molecular weight of 288.18 g/mol. IUPAC name: 7-bromo-1,1,2-trimethylbenzo[e]indole. InChIKey: OJKFWXNRBKESAI-UHFFFAOYSA-N.
| Molecular formula | C15H14BrN |
|---|---|
| Molecular weight | 288.18 g/mol |
| IUPAC name | 7-bromo-1,1,2-trimethylbenzo[e]indole |
| InChIKey | OJKFWXNRBKESAI-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)C)C3=C(C=C2)C=C(C=C3)Br |
Computed by PubChem (NCBI)