Products 2050948-14-4
CAS 2050948-14-4 is the registry number for 3-Bromo-9,9-dimethyl-9H-fluoren-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
3-bromo-9,9-dimethylfluoren-2-amine (CAS 2050948-14-4) is a chemical compound with the molecular formula C15H14BrN and a molecular weight of 288.18 g/mol. IUPAC name: 3-bromo-9,9-dimethylfluoren-2-amine. InChIKey: POYDHRXTCKEBHG-UHFFFAOYSA-N.
| Molecular formula | C15H14BrN |
|---|---|
| Molecular weight | 288.18 g/mol |
| IUPAC name | 3-bromo-9,9-dimethylfluoren-2-amine |
| InChIKey | POYDHRXTCKEBHG-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=CC(=C(C=C31)N)Br)C |
Computed by PubChem (NCBI)