Products 1057326-61-0
CAS 1057326-61-0 is the registry number for (2S,3R)-2-{((tert-Butoxy)carbonyl)amino}-3-(prop-2-yn-1-yloxy)butanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-ynoxybutanoic acid (CAS 1057326-61-0) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: (2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-ynoxybutanoic acid. InChIKey: BJPBXKJWPNSXPN-BDAKNGLRSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | (2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-ynoxybutanoic acid |
| InChIKey | BJPBXKJWPNSXPN-BDAKNGLRSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OC(C)(C)C)OCC#C |
Computed by PubChem (NCBI)