CAS 105738-24-7 is the registry number for 4-Methyl-2-oxo-2h-chromen-7-yl chloroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4-methyl-2-oxochromen-7-yl) 2-chloroacetate (CAS 105738-24-7) is a chemical compound with the molecular formula C12H9ClO4 and a molecular weight of 252.65 g/mol. IUPAC name: (4-methyl-2-oxochromen-7-yl) 2-chloroacetate. InChIKey: DNVAMQZOGHDQNS-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO4 |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | (4-methyl-2-oxochromen-7-yl) 2-chloroacetate |
| InChIKey | DNVAMQZOGHDQNS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC(=O)CCl |
Computed by PubChem (NCBI)