CAS 675602-86-5 is the registry number for 6-Chloro-7-methylchromone-2-carboxylic acid methyl ester. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 10g.
Methyl 6-chloro-7-methyl-4-oxochromene-2-carboxylate (CAS 675602-86-5) is a chemical compound with the molecular formula C12H9ClO4 and a molecular weight of 252.65 g/mol. IUPAC name: methyl 6-chloro-7-methyl-4-oxochromene-2-carboxylate. InChIKey: LVPDIWHUJJYADL-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO4 |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | methyl 6-chloro-7-methyl-4-oxochromene-2-carboxylate |
| InChIKey | LVPDIWHUJJYADL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)C(=O)C=C(O2)C(=O)OC |
Computed by PubChem (NCBI)