Products 675602-86-5

CAS 675602-86-5 is the registry number for 6-Chloro-7-methylchromone-2-carboxylic acid methyl ester. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Methyl 6-chloro-7-methyl-4-oxochromene-2-carboxylate (CAS 675602-86-5) is a chemical compound with the molecular formula C12H9ClO4 and a molecular weight of 252.65 g/mol. IUPAC name: methyl 6-chloro-7-methyl-4-oxochromene-2-carboxylate. InChIKey: LVPDIWHUJJYADL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9ClO4
Molecular weight252.65 g/mol
IUPAC namemethyl 6-chloro-7-methyl-4-oxochromene-2-carboxylate
InChIKeyLVPDIWHUJJYADL-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1Cl)C(=O)C=C(O2)C(=O)OC

Computed by PubChem (NCBI)