CAS 74556-57-3 appears in our catalog under these names: 5-[(4-Chlorophenoxy)methyl]-2-furoic acid, 95%, 5-(4-Chloro-phenoxymethyl)-furan-2-carboxylic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
5-[(4-chlorophenoxy)methyl]furan-2-carboxylic acid (CAS 74556-57-3) is a chemical compound with the molecular formula C12H9ClO4 and a molecular weight of 252.65 g/mol. IUPAC name: 5-[(4-chlorophenoxy)methyl]furan-2-carboxylic acid. InChIKey: MPRKNOQRXNTZGV-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO4 |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | 5-[(4-chlorophenoxy)methyl]furan-2-carboxylic acid |
| InChIKey | MPRKNOQRXNTZGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC2=CC=C(O2)C(=O)O)Cl |
Computed by PubChem (NCBI)