CAS 105786-35-4 appears in our catalog under these names: Diexo-3-amino-bicyclo[2.2.1]heptane-2-carboxylic acid ethyl ester, 95%, rel-Ethyl (1R,2S,3R,4S)-3-Aminobicyclo(2.2.1)heptane-2-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Ethyl (1R,2S,3R,4S)-3-aminobicyclo[2.2.1]heptane-2-carboxylate (CAS 105786-35-4) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: ethyl (1R,2S,3R,4S)-3-aminobicyclo[2.2.1]heptane-2-carboxylate. InChIKey: UIFFSCXLBNDAFP-RYPBNFRJSA-N.
| Molecular formula | C10H17NO2 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | ethyl (1R,2S,3R,4S)-3-aminobicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | UIFFSCXLBNDAFP-RYPBNFRJSA-N |
| SMILES | CCOC(=O)[C@H]1[C@@H]2CC[C@@H](C2)[C@H]1N |
Computed by PubChem (NCBI)