CAS 105799-70-0 is the registry number for Ethyl 8-fluoro-4h-[1]-benzopyrano[4,3-b]thiophene-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 8-fluoro-4H-thieno[3,2-c]chromene-2-carboxylate (CAS 105799-70-0) is a chemical compound with the molecular formula C14H11FO3S and a molecular weight of 278.30 g/mol. IUPAC name: ethyl 8-fluoro-4H-thieno[3,2-c]chromene-2-carboxylate. InChIKey: RJJIHFVEBLDZCR-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3S |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | ethyl 8-fluoro-4H-thieno[3,2-c]chromene-2-carboxylate |
| InChIKey | RJJIHFVEBLDZCR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)C3=C(C=CC(=C3)F)OC2 |
Computed by PubChem (NCBI)