CAS 41024-58-2 is the registry number for 2-(Benzenesulfonyl)-1-(4-fluorophenyl)ethan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(benzenesulfonyl)-1-(4-fluorophenyl)ethanone (CAS 41024-58-2) is a chemical compound with the molecular formula C14H11FO3S and a molecular weight of 278.30 g/mol. IUPAC name: 2-(benzenesulfonyl)-1-(4-fluorophenyl)ethanone. InChIKey: FCXNRTNBPQUTBL-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3S |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 2-(benzenesulfonyl)-1-(4-fluorophenyl)ethanone |
| InChIKey | FCXNRTNBPQUTBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)