CAS 197438-91-8 appears in our catalog under these names: (4-Fluorophenyl)(4-methanesulfonylphenyl)methanone, 95%, 95%, (4-Fluorophenyl)(4-methanesulfonylphenyl)methanone, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(4-fluorophenyl)-(4-methylsulfonylphenyl)methanone (CAS 197438-91-8) is a chemical compound with the molecular formula C14H11FO3S and a molecular weight of 278.30 g/mol. IUPAC name: (4-fluorophenyl)-(4-methylsulfonylphenyl)methanone. InChIKey: HYUDUBGICRHDPP-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3S |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | (4-fluorophenyl)-(4-methylsulfonylphenyl)methanone |
| InChIKey | HYUDUBGICRHDPP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)