CAS 1058132-77-6 is the registry number for (3S,4R)-Ethyl-4-hydroxypyrrolidine-3-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl (3S,4R)-4-hydroxypyrrolidine-3-carboxylate (CAS 1058132-77-6) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. IUPAC name: ethyl (3S,4R)-4-hydroxypyrrolidine-3-carboxylate. InChIKey: KWCCUOFJQUMIMH-WDSKDSINSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | ethyl (3S,4R)-4-hydroxypyrrolidine-3-carboxylate |
| InChIKey | KWCCUOFJQUMIMH-WDSKDSINSA-N |
| SMILES | CCOC(=O)[C@H]1CNC[C@@H]1O |
Computed by PubChem (NCBI)