CAS 2253105-21-2 is the registry number for Ethyl (3r,4s)-4-hydroxypyrrolidine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
Ethyl (3R,4S)-4-hydroxypyrrolidine-3-carboxylate (CAS 2253105-21-2) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. IUPAC name: ethyl (3R,4S)-4-hydroxypyrrolidine-3-carboxylate. InChIKey: KWCCUOFJQUMIMH-PHDIDXHHSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | ethyl (3R,4S)-4-hydroxypyrrolidine-3-carboxylate |
| InChIKey | KWCCUOFJQUMIMH-PHDIDXHHSA-N |
| SMILES | CCOC(=O)[C@@H]1CNC[C@H]1O |
Computed by PubChem (NCBI)