CAS 752936-83-7 is the registry number for (3S,4S)-Ethyl 4-hydroxypyrrolidine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R,4R)-4-hydroxypyrrolidine-3-carboxylate (CAS 752936-83-7) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. IUPAC name: ethyl (3R,4R)-4-hydroxypyrrolidine-3-carboxylate. InChIKey: KWCCUOFJQUMIMH-RITPCOANSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | ethyl (3R,4R)-4-hydroxypyrrolidine-3-carboxylate |
| InChIKey | KWCCUOFJQUMIMH-RITPCOANSA-N |
| SMILES | CCOC(=O)[C@@H]1CNC[C@@H]1O |
Computed by PubChem (NCBI)