CAS 1058722-45-4 appears in our catalog under these names: 4-Hydroxy-Teriflunomide, Teriflunomide Impurity 8. Offered by: TRC, Hubei YoungXin. Available pack sizes: 50mg, 10mg, 25mg, 100mg, 200mg.
(Z)-2-cyano-3,4-dihydroxy-N-[4-(trifluoromethyl)phenyl]but-2-enamide (CAS 1058722-45-4) is a chemical compound with the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. IUPAC name: (Z)-2-cyano-3,4-dihydroxy-N-[4-(trifluoromethyl)phenyl]but-2-enamide. InChIKey: WHYQOFDUXDGMTM-KTKRTIGZSA-N.
| Molecular formula | C12H9F3N2O3 |
|---|---|
| Molecular weight | 286.21 g/mol |
| IUPAC name | (Z)-2-cyano-3,4-dihydroxy-N-[4-(trifluoromethyl)phenyl]but-2-enamide |
| InChIKey | WHYQOFDUXDGMTM-KTKRTIGZSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)NC(=O)/C(=C(/CO)\O)/C#N |
Computed by PubChem (NCBI)