CAS 1058722-46-5 appears in our catalog under these names: 5-Hydroxy Leflunomide (Metabolite M2), 5-(Hydroxymethyl)-N-(4-(trifluoromethyl)phenyl)-4-isoxazolecarboxamide. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 25mg.
5-(hydroxymethyl)-N-[4-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide (CAS 1058722-46-5) is a chemical compound with the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. IUPAC name: 5-(hydroxymethyl)-N-[4-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide. InChIKey: PDBLFERZFMEGMZ-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O3 |
|---|---|
| Molecular weight | 286.21 g/mol |
| IUPAC name | 5-(hydroxymethyl)-N-[4-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide |
| InChIKey | PDBLFERZFMEGMZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)NC(=O)C2=C(ON=C2)CO |
Computed by PubChem (NCBI)