Products 105879-62-7
CAS 105879-62-7 appears in our catalog under these names: (R)-2-(4-Chlorophenyl)propanoic acid, 97%, (R)-2-(4-Chlorophenyl)propanoic acid, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 100mg.
(2R)-2-(4-chlorophenyl)propanoic acid (CAS 105879-62-7) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: (2R)-2-(4-chlorophenyl)propanoic acid. InChIKey: YOZILQVNIWNPFP-ZCFIWIBFSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | (2R)-2-(4-chlorophenyl)propanoic acid |
| InChIKey | YOZILQVNIWNPFP-ZCFIWIBFSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)