CAS 105901-47-1 is the registry number for 4-Methyl-3-(phenylsulfanyl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-methyl-3-phenylsulfanylaniline (CAS 105901-47-1) is a chemical compound with the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. IUPAC name: 4-methyl-3-phenylsulfanylaniline. InChIKey: XTEGKJLIHFHKRY-UHFFFAOYSA-N.
| Molecular formula | C13H13NS |
|---|---|
| Molecular weight | 215.32 g/mol |
| IUPAC name | 4-methyl-3-phenylsulfanylaniline |
| InChIKey | XTEGKJLIHFHKRY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)SC2=CC=CC=C2 |
Computed by PubChem (NCBI)