CAS 105946-33-6 is the registry number for 4-(Benzyloxy)-2,6-dibromophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2,6-dibromo-4-phenylmethoxyphenol (CAS 105946-33-6) is a chemical compound with the molecular formula C13H10Br2O2 and a molecular weight of 358.02 g/mol. IUPAC name: 2,6-dibromo-4-phenylmethoxyphenol. InChIKey: RZVCFOHBMSYGJT-UHFFFAOYSA-N.
| Molecular formula | C13H10Br2O2 |
|---|---|
| Molecular weight | 358.02 g/mol |
| IUPAC name | 2,6-dibromo-4-phenylmethoxyphenol |
| InChIKey | RZVCFOHBMSYGJT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C(=C2)Br)O)Br |
Computed by PubChem (NCBI)