CAS 52997-56-5 is the registry number for 2,2-Dibromo-1-(6-methoxynaphthalen-2-yl)ethanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-1-(6-methoxynaphthalen-2-yl)ethanone (CAS 52997-56-5) is a chemical compound with the molecular formula C13H10Br2O2 and a molecular weight of 358.02 g/mol. IUPAC name: 2,2-dibromo-1-(6-methoxynaphthalen-2-yl)ethanone. InChIKey: DEUCQVRMYOWSSJ-UHFFFAOYSA-N.
| Molecular formula | C13H10Br2O2 |
|---|---|
| Molecular weight | 358.02 g/mol |
| IUPAC name | 2,2-dibromo-1-(6-methoxynaphthalen-2-yl)ethanone |
| InChIKey | DEUCQVRMYOWSSJ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C(=O)C(Br)Br |
Computed by PubChem (NCBI)