CAS 78563-03-8 is the registry number for 2,2'-Methylenebis(4-bromophenol). Offered by: TRC. Available pack sizes: 1g, 25g, 5g.
4-bromo-2-[(5-bromo-2-hydroxyphenyl)methyl]phenol (CAS 78563-03-8) is a chemical compound with the molecular formula C13H10Br2O2 and a molecular weight of 358.02 g/mol. IUPAC name: 4-bromo-2-[(5-bromo-2-hydroxyphenyl)methyl]phenol. InChIKey: FGDRHERYMWECPV-UHFFFAOYSA-N.
| Molecular formula | C13H10Br2O2 |
|---|---|
| Molecular weight | 358.02 g/mol |
| IUPAC name | 4-bromo-2-[(5-bromo-2-hydroxyphenyl)methyl]phenol |
| InChIKey | FGDRHERYMWECPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CC2=C(C=CC(=C2)Br)O)O |
Computed by PubChem (NCBI)