CAS 105958-72-3 is the registry number for 2-(3-Nitro-1H-1,2,4-triazol-1-yl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-nitro-1,2,4-triazol-1-yl)ethanol (CAS 105958-72-3) is a chemical compound with the molecular formula C4H6N4O3 and a molecular weight of 158.12 g/mol. IUPAC name: 2-(3-nitro-1,2,4-triazol-1-yl)ethanol. InChIKey: ZRPSEMIBVBQGIF-UHFFFAOYSA-N.
| Molecular formula | C4H6N4O3 |
|---|---|
| Molecular weight | 158.12 g/mol |
| IUPAC name | 2-(3-nitro-1,2,4-triazol-1-yl)ethanol |
| InChIKey | ZRPSEMIBVBQGIF-UHFFFAOYSA-N |
| SMILES | C1=NC(=NN1CCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)