CAS 855750-87-7 appears in our catalog under these names: N-(2-Azidoacetyl)glycine dcha salt, 95%, N3–Gly–Gly–OH, N3-Gly-Gly-OH*DCHA, N3-Gly-Gly-OH, 98%, 98%, N3-Gly-Gly-OH, 98.40%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 250mg, 10mg, 25mg, 5mg, 25g, 500mg.
2-[(2-azidoacetyl)amino]acetic acid (CAS 855750-87-7) is a chemical compound with the molecular formula C4H6N4O3 and a molecular weight of 158.12 g/mol. IUPAC name: 2-[(2-azidoacetyl)amino]acetic acid. InChIKey: FIPPSTNVFPJXRD-UHFFFAOYSA-N.
| Molecular formula | C4H6N4O3 |
|---|---|
| Molecular weight | 158.12 g/mol |
| IUPAC name | 2-[(2-azidoacetyl)amino]acetic acid |
| InChIKey | FIPPSTNVFPJXRD-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)NC(=O)CN=[N+]=[N-] |
Computed by PubChem (NCBI)