Products 1219402-51-3
CAS 1219402-51-3 appears in our catalog under these names: Allantoin-13C2,15N4, >95% (HPLC), Allantoin–13C2,15N4, Allantoin-13C2,15N4, Allantoin-13C2,15N4, 99.90%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 500μg, 5mg, 25mg, 50mg, 500 μg, 1 mg.
(2,5-dioxo-(213C,1,3-15N2)1,3-diazolidin-4-yl)(13C)urea (CAS 1219402-51-3) is a chemical compound with the molecular formula C4H6N4O3 and a molecular weight of 164.07 g/mol. IUPAC name: (2,5-dioxo-(213C,1,3-15N2)1,3-diazolidin-4-yl)(13C)urea. InChIKey: POJWUDADGALRAB-LSYAIDEBSA-N.
| Molecular formula | C4H6N4O3 |
|---|---|
| Molecular weight | 164.07 g/mol |
| IUPAC name | (2,5-dioxo-(213C,1,3-15N2)1,3-diazolidin-4-yl)(13C)urea |
| InChIKey | POJWUDADGALRAB-LSYAIDEBSA-N |
| SMILES | C1(C(=O)[15NH][13C](=O)[15NH]1)[15NH][13C](=O)[15NH2] |
Computed by PubChem (NCBI)