Products 1059678-65-7
CAS 1059678-65-7 appears in our catalog under these names: Methyl 2-(3'-amino-[1,1'-biphenyl]-3-yl)acetate, 95+%, Methyl 2-(3'-amino-[1,1'-biphenyl]-3-yl)acetate, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2-[3-(3-aminophenyl)phenyl]acetate (CAS 1059678-65-7) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: methyl 2-[3-(3-aminophenyl)phenyl]acetate. InChIKey: IAAHGDFSVPBOQN-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | methyl 2-[3-(3-aminophenyl)phenyl]acetate |
| InChIKey | IAAHGDFSVPBOQN-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=CC=C1)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)