CAS 105994-56-7 is the registry number for 1-Methyl-3-phenyl-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-methyl-3-phenylpyrazole-4-carboxylic acid (CAS 105994-56-7) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 1-methyl-3-phenylpyrazole-4-carboxylic acid. InChIKey: YMSOQSQLQLWDQI-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 1-methyl-3-phenylpyrazole-4-carboxylic acid |
| InChIKey | YMSOQSQLQLWDQI-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)