Products 106001-67-6
CAS 106001-67-6 is the registry number for Furan-2-yl(5-(hydroxymethyl)furan-2-yl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.
Furan-2-yl-[5-(hydroxymethyl)furan-2-yl]methanol (CAS 106001-67-6) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: furan-2-yl-[5-(hydroxymethyl)furan-2-yl]methanol. InChIKey: IGVFXDGWMNTOFH-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | furan-2-yl-[5-(hydroxymethyl)furan-2-yl]methanol |
| InChIKey | IGVFXDGWMNTOFH-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(C2=CC=C(O2)CO)O |
Computed by PubChem (NCBI)