CAS 106024-58-2 is the registry number for (1H-Indol-2-ylmethyl)amine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1H-indol-2-ylmethanamine;oxalic acid (CAS 106024-58-2) is a chemical compound with the molecular formula C11H12N2O4 and a molecular weight of 236.22 g/mol. IUPAC name: 1H-indol-2-ylmethanamine;oxalic acid. InChIKey: KDJIUYHNTDDXKW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 1H-indol-2-ylmethanamine;oxalic acid |
| InChIKey | KDJIUYHNTDDXKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)