CAS 40832-81-3 appears in our catalog under these names: 3-Nitro-4-pyrrolidin-1-ylbenzoic acid, 95%, 3-Nitro-4-(pyrrolidin-1-yl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 2,5g.
3-nitro-4-pyrrolidin-1-ylbenzoic acid (CAS 40832-81-3) is a chemical compound with the molecular formula C11H12N2O4 and a molecular weight of 236.22 g/mol. IUPAC name: 3-nitro-4-pyrrolidin-1-ylbenzoic acid. InChIKey: MKTQASLRSMDHRE-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 3-nitro-4-pyrrolidin-1-ylbenzoic acid |
| InChIKey | MKTQASLRSMDHRE-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)