CAS 5397-76-2 appears in our catalog under these names: Morpholino(4-nitrophenyl)methanone, 96%, 4-(4-nitrobenzoyl)morpholine. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g.
Morpholin-4-yl-(4-nitrophenyl)methanone (CAS 5397-76-2) is a chemical compound with the molecular formula C11H12N2O4 and a molecular weight of 236.22 g/mol. IUPAC name: morpholin-4-yl-(4-nitrophenyl)methanone. InChIKey: VGGZQWDRWOXJTA-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | morpholin-4-yl-(4-nitrophenyl)methanone |
| InChIKey | VGGZQWDRWOXJTA-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)