CAS 106032-60-4 appears in our catalog under these names: D–Glucose–d1–3, D-Glucose-d1-3, 99.90%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 10 mg, 5 mg.
3-deuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (CAS 106032-60-4) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.16 g/mol. IUPAC name: 3-deuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-UICOGKGYSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | 3-deuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-UICOGKGYSA-N |
| SMILES | [2H]C1(C(C(C(OC1O)CO)O)O)O |
Computed by PubChem (NCBI)