CAS 106032-62-6 appears in our catalog under these names: D-Glucose-6-13C, D-GLUCOSE-6-13C, 99 ATOM % 13C, D-Glucose-6-13C, 98% 98%atom%13C, D-Glucopyranose-6-13C, ≥98%,≥99atom%¹³C, ≥98%,≥99atom%¹³C, D-Glucose-13C-5, 98.0%. Offered by: Biosynth, Sigma-Aldrich, Chemat Brand, Chemat, MedChemExpress. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg, on request, 5mg, 25mg.
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(613C)hexanal (CAS 106032-62-6) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.15 g/mol. IUPAC name: (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(613C)hexanal. InChIKey: GZCGUPFRVQAUEE-HYISWWFJSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(613C)hexanal |
| InChIKey | GZCGUPFRVQAUEE-HYISWWFJSA-N |
| SMILES | [13CH2]([C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)O |
Computed by PubChem (NCBI)