Products 201595-65-5
CAS 201595-65-5 appears in our catalog under these names: D-Fructose-13c6, 95%, D-Fructose-13C6, D-Fructose-13C6, >95% (HPLC), D–Fructose–13C6, D-Fructose-¹³C6. Offered by: Combi-blocks, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 100mg, 1g, 250mg, on request, 25mg, 5mg, 1mg, 50mg.
(3S,4R,5R)-1,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexan-2-one (CAS 201595-65-5) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 186.11 g/mol. IUPAC name: (3S,4R,5R)-1,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexan-2-one. InChIKey: BJHIKXHVCXFQLS-HJLYHLTLSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 186.11 g/mol |
| IUPAC name | (3S,4R,5R)-1,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexan-2-one |
| InChIKey | BJHIKXHVCXFQLS-HJLYHLTLSA-N |
| SMILES | [13CH2]([13C@H]([13C@H]([13C@@H]([13C](=O)[13CH2]O)O)O)O)O |
Computed by PubChem (NCBI)