Products 106055-12-3
CAS 106055-12-3 is the registry number for Racemoflavone. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-8,8-dimethylpyrano[2,3-h]chromen-4-one (CAS 106055-12-3) is a chemical compound with the molecular formula C21H18O6 and a molecular weight of 366.4 g/mol. IUPAC name: 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-8,8-dimethylpyrano[2,3-h]chromen-4-one. InChIKey: AGOMJPUUTGWSSH-UHFFFAOYSA-N.
| Molecular formula | C21H18O6 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-8,8-dimethylpyrano[2,3-h]chromen-4-one |
| InChIKey | AGOMJPUUTGWSSH-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=C(C3=C2OC(=CC3=O)C4=CC(=C(C=C4)O)OC)O)C |
Computed by PubChem (NCBI)