CAS 1848971-16-3 is the registry number for SLCB050. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (E)-3-(furan-2-yl)prop-2-enoate (CAS 1848971-16-3) is a chemical compound with the molecular formula C21H18O6 and a molecular weight of 366.4 g/mol. IUPAC name: [(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (E)-3-(furan-2-yl)prop-2-enoate. InChIKey: AUIHPJIGBDPOCO-IWHGQQBYSA-N.
| Molecular formula | C21H18O6 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | [(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (E)-3-(furan-2-yl)prop-2-enoate |
| InChIKey | AUIHPJIGBDPOCO-IWHGQQBYSA-N |
| SMILES | CC1([C@H](CC2=C(O1)C=C3C(=C2)C=CC(=O)O3)OC(=O)/C=C/C4=CC=CO4)C |
Computed by PubChem (NCBI)