CAS 1616592-59-6 is the registry number for Erythrinin D. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
4-hydroxy-6-(4-hydroxyphenyl)-2-(2-methoxypropan-2-yl)furo[3,2-g]chromen-5-one (CAS 1616592-59-6) is a chemical compound with the molecular formula C21H18O6 and a molecular weight of 366.4 g/mol. IUPAC name: 4-hydroxy-6-(4-hydroxyphenyl)-2-(2-methoxypropan-2-yl)furo[3,2-g]chromen-5-one. InChIKey: ZOHYOAYYYIFCIL-UHFFFAOYSA-N.
| Molecular formula | C21H18O6 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 4-hydroxy-6-(4-hydroxyphenyl)-2-(2-methoxypropan-2-yl)furo[3,2-g]chromen-5-one |
| InChIKey | ZOHYOAYYYIFCIL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC2=C(C3=C(C=C2O1)OC=C(C3=O)C4=CC=C(C=C4)O)O)OC |
Computed by PubChem (NCBI)