CAS 1060802-41-6 appears in our catalog under these names: 2,2,2-Trifluoro-1-(3-fluoropyridin-2-yl)ethanone, 95%, 2,2,2–Trifluoro–1–(3–fluoropyridin–2–yl)ethanone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2,2,2-trifluoro-1-(3-fluoro-2-pyridinyl)ethanone (CAS 1060802-41-6) is a chemical compound with the molecular formula C7H3F4NO and a molecular weight of 193.10 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-fluoro-2-pyridinyl)ethanone. InChIKey: MLPYWARPLGQRPY-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO |
|---|---|
| Molecular weight | 193.10 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(3-fluoro-2-pyridinyl)ethanone |
| InChIKey | MLPYWARPLGQRPY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)