Products 1227585-11-6
CAS 1227585-11-6 is the registry number for 3-Fluoro-6-(trifluoromethyl)picolinaldehyde 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
3-fluoro-6-(trifluoromethyl)pyridine-2-carbaldehyde (CAS 1227585-11-6) is a chemical compound with the molecular formula C7H3F4NO and a molecular weight of 193.10 g/mol. IUPAC name: 3-fluoro-6-(trifluoromethyl)pyridine-2-carbaldehyde. InChIKey: ULKUSSWPEAJRIR-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO |
|---|---|
| Molecular weight | 193.10 g/mol |
| IUPAC name | 3-fluoro-6-(trifluoromethyl)pyridine-2-carbaldehyde |
| InChIKey | ULKUSSWPEAJRIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1F)C=O)C(F)(F)F |
Computed by PubChem (NCBI)