CAS 950687-45-3 appears in our catalog under these names: 2,2,2-Trifluoro-1-(6-fluoropyridin-3-yl)ethan-1-one, 98%, 2,2,2-Trifluoro-1-(6-fluoropyridin-3-yl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,2,2-trifluoro-1-(6-fluoro-3-pyridinyl)ethanone (CAS 950687-45-3) is a chemical compound with the molecular formula C7H3F4NO and a molecular weight of 193.10 g/mol. IUPAC name: 2,2,2-trifluoro-1-(6-fluoro-3-pyridinyl)ethanone. InChIKey: IFFJWJHMUMGZQH-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO |
|---|---|
| Molecular weight | 193.10 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(6-fluoro-3-pyridinyl)ethanone |
| InChIKey | IFFJWJHMUMGZQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)