CAS 1060803-86-2 appears in our catalog under these names: 2–Bromo–5–(piperidin–1–yl)pyrazine, 2-Bromo-5-(piperidin-1-yl)pyrazine, 95%, 2-Bromo-5-(piperidin-1-yl)pyrazine, 95%, 95%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-5-piperidin-1-ylpyrazine (CAS 1060803-86-2) is a chemical compound with the molecular formula C9H12BrN3 and a molecular weight of 242.12 g/mol. IUPAC name: 2-bromo-5-piperidin-1-ylpyrazine. InChIKey: SXASQQOKUXUBLI-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3 |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 2-bromo-5-piperidin-1-ylpyrazine |
| InChIKey | SXASQQOKUXUBLI-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CN=C(C=N2)Br |
Computed by PubChem (NCBI)