Products 1060805-66-4
CAS 1060805-66-4 appears in our catalog under these names: 4–Bromo–6–chloropicolinic acid, 4-Bromo-6-chloropicolinic acid, 4-Bromo-6-chloropicolinic acid 97%, 4-Bromo-6-chloropicolinic acid, 97%, 4-Bromo-6-chloro-2-pyridinecarboxylic Acid. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, TRC. Available pack sizes: 100mg, 1g, 250mg, 2g, 5g, 10g, 25g, 2.5g.
4-bromo-6-chloropyridine-2-carboxylic acid (CAS 1060805-66-4) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 4-bromo-6-chloropyridine-2-carboxylic acid. InChIKey: LURFXJAIIJVQFA-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 4-bromo-6-chloropyridine-2-carboxylic acid |
| InChIKey | LURFXJAIIJVQFA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(=O)O)Cl)Br |
Computed by PubChem (NCBI)