Products 1060806-62-3
CAS 1060806-62-3 appears in our catalog under these names: 6-Bromo-2-methoxypyridine-3-carboxylic acid, 98%, 6–Bromo–2–methoxynicotinic acid, 6-Bromo-2-methoxynicotinic acid, 6-Bromo-2-methoxynicotinic acid 95%, 6-Bromo-2-methoxynicotinic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg, 0,5g.
6-bromo-2-methoxypyridine-3-carboxylic acid (CAS 1060806-62-3) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 6-bromo-2-methoxypyridine-3-carboxylic acid. InChIKey: YMPQUJFCCCPCAF-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 6-bromo-2-methoxypyridine-3-carboxylic acid |
| InChIKey | YMPQUJFCCCPCAF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=N1)Br)C(=O)O |
Computed by PubChem (NCBI)