Products 1060808-92-5
CAS 1060808-92-5 appears in our catalog under these names: 6-bromo-4-chloronicotinic acid, 6-Bromo-4-chloronicotinic acid 97%, 6-Bromo-4-chloronicotinic acid, 97%, 97%, 6-Bromo-4-chloronicotinic acid, 96%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 100mg, 250mg, 5g, 25g, 2.5g.
6-bromo-4-chloropyridine-3-carboxylic acid (CAS 1060808-92-5) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 6-bromo-4-chloropyridine-3-carboxylic acid. InChIKey: XWVFYJPQFMTKCQ-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 6-bromo-4-chloropyridine-3-carboxylic acid |
| InChIKey | XWVFYJPQFMTKCQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Br)C(=O)O)Cl |
Computed by PubChem (NCBI)