Products 1060810-73-2
CAS 1060810-73-2 appears in our catalog under these names: 4-Amino-6-(trifluoromethyl)picolinic acid, 97%, 4-Amino-6-(trifluoromethyl)picolinic acid, 97%, 97%, 4-AMINO-6-(TRIFLUOROMETHYL)PYRIDINE-2-CARBOXYLIC ACID, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g.
4-amino-6-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 1060810-73-2) is a chemical compound with the molecular formula C7H5F3N2O2 and a molecular weight of 206.12 g/mol. IUPAC name: 4-amino-6-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: KUJMRAJCKDRZCH-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O2 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 4-amino-6-(trifluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | KUJMRAJCKDRZCH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(=O)O)C(F)(F)F)N |
Computed by PubChem (NCBI)