CAS 1060814-50-7 appears in our catalog under these names: 5–(Trifluoromethyl)pyrazine–2–carboxylic acid, 5-(Trifluoromethyl)pyrazine-2-carboxylic Acid, 5-(Trifluoromethyl)pyrazine-2-carboxylic acid, 95%, 95%, 5-(Trifluoromethyl)pyrazine-2-carboxylic acid, 98%, 5-(Trifluoromethyl)pyrazine-2-carboxylic acid, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 500mg, 1g, 10g.
5-(trifluoromethyl)pyrazine-2-carboxylic acid (CAS 1060814-50-7) is a chemical compound with the molecular formula C6H3F3N2O2 and a molecular weight of 192.10 g/mol. IUPAC name: 5-(trifluoromethyl)pyrazine-2-carboxylic acid. InChIKey: DDVCRZPGVDGULO-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N2O2 |
|---|---|
| Molecular weight | 192.10 g/mol |
| IUPAC name | 5-(trifluoromethyl)pyrazine-2-carboxylic acid |
| InChIKey | DDVCRZPGVDGULO-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)