CAS 1060815-03-3 appears in our catalog under these names: 5-(Trifluoromethoxy)pyridine-3-carboxylic acid, 5-(Trifluoromethoxy)nicotinic acid, 95%, 5-(Trifluoromethoxy)nicotinic acid, 95+%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 50mg, 1g, 250mg, 100mg.
5-(trifluoromethoxy)pyridine-3-carboxylic acid (CAS 1060815-03-3) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 5-(trifluoromethoxy)pyridine-3-carboxylic acid. InChIKey: VBMNFJZPPOJEBI-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 5-(trifluoromethoxy)pyridine-3-carboxylic acid |
| InChIKey | VBMNFJZPPOJEBI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)