CAS 1060817-63-1 appears in our catalog under these names: 4-(5-Isoxazolyl)-2-thiophenesulfonyl chloride, 95%, 4-(Isoxazol-5-yl)thiophene-2-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
4-(1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride (CAS 1060817-63-1) is a chemical compound with the molecular formula C7H4ClNO3S2 and a molecular weight of 249.7 g/mol. IUPAC name: 4-(1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride. InChIKey: BJBJAMREHYSGCC-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3S2 |
|---|---|
| Molecular weight | 249.7 g/mol |
| IUPAC name | 4-(1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride |
| InChIKey | BJBJAMREHYSGCC-UHFFFAOYSA-N |
| SMILES | C1=C(ON=C1)C2=CSC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)