Products 1060817-63-1

CAS 1060817-63-1 appears in our catalog under these names: 4-(5-Isoxazolyl)-2-thiophenesulfonyl chloride, 95%, 4-(Isoxazol-5-yl)thiophene-2-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride (CAS 1060817-63-1) is a chemical compound with the molecular formula C7H4ClNO3S2 and a molecular weight of 249.7 g/mol. IUPAC name: 4-(1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride. InChIKey: BJBJAMREHYSGCC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClNO3S2
Molecular weight249.7 g/mol
IUPAC name4-(1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride
InChIKeyBJBJAMREHYSGCC-UHFFFAOYSA-N
SMILESC1=C(ON=C1)C2=CSC(=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)