CAS 62425-99-4 appears in our catalog under these names: 2-Oxo-2,3-dihydro-1,3-benzothiazole-6-sulfonyl chloride, 95%, 2-Oxo-2,3-dihydro-benzothiazole-6-sulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 250mg, 0,5g.
2-oxo-3H-1,3-benzothiazole-6-sulfonyl chloride (CAS 62425-99-4) is a chemical compound with the molecular formula C7H4ClNO3S2 and a molecular weight of 249.7 g/mol. IUPAC name: 2-oxo-3H-1,3-benzothiazole-6-sulfonyl chloride. InChIKey: XTLMRZGHSSZIIR-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3S2 |
|---|---|
| Molecular weight | 249.7 g/mol |
| IUPAC name | 2-oxo-3H-1,3-benzothiazole-6-sulfonyl chloride |
| InChIKey | XTLMRZGHSSZIIR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)Cl)SC(=O)N2 |
Computed by PubChem (NCBI)