Products 551930-53-1

CAS 551930-53-1 is the registry number for 5-Isoxazol-5-ylthiophene-2-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

5-(1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride (CAS 551930-53-1) is a chemical compound with the molecular formula C7H4ClNO3S2 and a molecular weight of 249.7 g/mol. IUPAC name: 5-(1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride. InChIKey: SSGKBJJYLTYNQD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClNO3S2
Molecular weight249.7 g/mol
IUPAC name5-(1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride
InChIKeySSGKBJJYLTYNQD-UHFFFAOYSA-N
SMILESC1=C(SC(=C1)S(=O)(=O)Cl)C2=CC=NO2

Computed by PubChem (NCBI)