CAS 551930-53-1 is the registry number for 5-Isoxazol-5-ylthiophene-2-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
5-(1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride (CAS 551930-53-1) is a chemical compound with the molecular formula C7H4ClNO3S2 and a molecular weight of 249.7 g/mol. IUPAC name: 5-(1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride. InChIKey: SSGKBJJYLTYNQD-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3S2 |
|---|---|
| Molecular weight | 249.7 g/mol |
| IUPAC name | 5-(1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride |
| InChIKey | SSGKBJJYLTYNQD-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)S(=O)(=O)Cl)C2=CC=NO2 |
Computed by PubChem (NCBI)