CAS 106083-71-0 appears in our catalog under these names: Bupropion Morpholinol Impurity (HCl Salt), Bupropion Impurity 14, (2S,3S)-Hydroxybupropion Hydrochloride, >95% (HPLC), Radafaxine hydrochloride (GW–353162A), Radafaxine (hydrochloride), 99.01%. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2,5mg.
(2S,3S)-2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol;hydrochloride (CAS 106083-71-0) is a chemical compound with the molecular formula C13H19Cl2NO2 and a molecular weight of 292.20 g/mol. IUPAC name: (2S,3S)-2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol;hydrochloride. InChIKey: ORXTVTDGPVINDN-BTJVGWIPSA-N.
| Molecular formula | C13H19Cl2NO2 |
|---|---|
| Molecular weight | 292.20 g/mol |
| IUPAC name | (2S,3S)-2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol;hydrochloride |
| InChIKey | ORXTVTDGPVINDN-BTJVGWIPSA-N |
| SMILES | C[C@H]1[C@@](OCC(N1)(C)C)(C2=CC(=CC=C2)Cl)O.Cl |
Computed by PubChem (NCBI)