CAS 866563-95-3 is the registry number for Hydroxy Bupropion Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol;hydrochloride (CAS 866563-95-3) is a chemical compound with the molecular formula C13H19Cl2NO2 and a molecular weight of 292.20 g/mol. IUPAC name: 2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol;hydrochloride. InChIKey: ORXTVTDGPVINDN-UHFFFAOYSA-N.
| Molecular formula | C13H19Cl2NO2 |
|---|---|
| Molecular weight | 292.20 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol;hydrochloride |
| InChIKey | ORXTVTDGPVINDN-UHFFFAOYSA-N |
| SMILES | CC1C(OCC(N1)(C)C)(C2=CC(=CC=C2)Cl)O.Cl |
Computed by PubChem (NCBI)